| Company Name: |
2D Pharma Gold |
| Tel: |
18920851381 18920851381 |
| Email: |
1626636005@qq.com |
|
| | bicyclo[2.2.1]heptane-1,4-dicarboxylic acid Basic information |
| | bicyclo[2.2.1]heptane-1,4-dicarboxylic acid Chemical Properties |
| Boiling point | 333.8±15.0 °C(Predicted) | | density | 1.544±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.23±0.10(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C9H12O4/c10-6(11)8-1-2-9(5-8,4-3-8)7(12)13/h1-5H2,(H,10,11)(H,12,13) | | InChIKey | XTHLMMQPSUSPPS-UHFFFAOYSA-N | | SMILES | C12(C(O)=O)CC(C(O)=O)(CC1)CC2 |
| | bicyclo[2.2.1]heptane-1,4-dicarboxylic acid Usage And Synthesis |
| | bicyclo[2.2.1]heptane-1,4-dicarboxylic acid Preparation Products And Raw materials |
|