VER-246608 manufacturers
- VER-246608
-
- $48.00
-
2026-07-14
- CAS:1684386-71-7
- Purity: 98.88%
- Supply Ability: 10g
|
| | VER-246608 Basic information |
| Product Name: | VER-246608 | | Synonyms: | VER-246608;N-[4-(2-chloro-5-methylpyrimidin-4-yl)phenyl]-N-[[4-[[(2,2-difluoroacetyl)amino]methyl]phenyl]methyl]-2,4-dihydroxybenzamide;Benzamide, N-[4-(2-chloro-5-methyl-4-pyrimidinyl)phenyl]-N-[[4-[[(2,2-difluoroacetyl)amino]methyl]phenyl]methyl]-2,4-dihydroxy-;VAR-246608;Inhibitor,VER 246608,PDHK,VER246608,VER-246608,Pyruvate dehydrogenase kinase,inhibit,PDH kinase;N-(4-(2-Chloro-5-methylpyrimidin-4-yl)phenyl)-N-(4-((2,2-difluoroacetamido)methyl)benzyl)-2,4-dihydroxybenzamide;VER-246608, 10 mM in DMSO | | CAS: | 1684386-71-7 | | MF: | C28H23ClF2N4O4 | | MW: | 552.96 | | EINECS: | | | Product Categories: | | | Mol File: | 1684386-71-7.mol |  |
| | VER-246608 Chemical Properties |
| Boiling point | 830.4±65.0 °C(Predicted) | | density | 1.414±0.06 g/cm3(Predicted) | | solubility | DMF:2.0(Max Conc. mg/mL);3.62(Max Conc. mM)
DMSO:2.0(Max Conc. mg/mL);3.62(Max Conc. mM)
DMSO:PBS (pH 7.2) (1:1):0.5(Max Conc. mg/mL);0.9(Max Conc. mM) | | form | A solid | | pka | 7.61±0.35(Predicted) | | color | White to off-white | | InChIKey | LCGNLQSOSJFLKR-UHFFFAOYSA-N | | SMILES | C(N(C1=CC=C(C2C(C)=CN=C(Cl)N=2)C=C1)CC1=CC=C(CNC(C(F)F)=O)C=C1)(=O)C1=CC=C(O)C=C1O |
| | VER-246608 Usage And Synthesis |
| Uses | VER-246608, is a novel pan-isoform ATP competitive inhibitor of pyruvate dehydrogenase kinase (PDK). | | storage | Store at -20°C |
| | VER-246608 Preparation Products And Raw materials |
|