|
|
| | (+)-(1R,4S)-N-Fmoc-4-aminocyclopent-2-enecarboxylic acid Basic information |
| | (+)-(1R,4S)-N-Fmoc-4-aminocyclopent-2-enecarboxylic acid Chemical Properties |
| Melting point | 229.8°C | | Boiling point | 483.57°C (rough estimate) | | density | 1.2520 (rough estimate) | | refractive index | 1.5614 (estimate) | | storage temp. | 2-8°C | | form | powder | | pka | 4.286±0.40(predicted) | | color | white | | Major Application | peptide synthesis | | InChI | 1S/C21H19NO4/c23-20(24)13-9-10-14(11-13)22-21(25)26-12-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-10,13-14,19H,11-12H2,(H,22,25)(H,23,24)/t13-,14+/m0/s1 | | InChIKey | IWMUNNGMJRKNSV-UONOGXRCSA-N | | SMILES | OC(=O)[C@@H]1C[C@H](NC(=O)OCC2c3ccccc3-c4ccccc24)C=C1 |
| WGK Germany | 3 | | F | 10 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | (+)-(1R,4S)-N-Fmoc-4-aminocyclopent-2-enecarboxylic acid Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | (+)-(1R,4S)-N-Fmoc-4-aminocyclopent-2-enecarboxylic acid Preparation Products And Raw materials |
|