- 2-Isocyanatobiphenyl
-
- $1.00 / 1kg
-
2019-07-06
- CAS:17337-13-2
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 200kg
|
| | 2-BIPHENYLYL ISOCYANATE Basic information |
| | 2-BIPHENYLYL ISOCYANATE Chemical Properties |
| Melting point | 56 °C | | Boiling point | 92-94 °C1 mm Hg(lit.) | | density | 1.138 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.606(lit.) | | Fp | >230 °F | | solubility | Chloroform (Soluble) | | form | clear liquid | | color | Colorless to Light yellow | | Stability: | Hygroscopic, Moisture Sensitive | | InChI | InChI=1S/C13H9NO/c15-10-14-13-9-5-4-8-12(13)11-6-2-1-3-7-11/h1-9H | | InChIKey | IHHUGFJSEJSCGE-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=CC=CC=C1N=C=O |
| | 2-BIPHENYLYL ISOCYANATE Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID | | Synthesis Reference(s) | Journal of the American Chemical Society, 76, p. 936, 1954 DOI: 10.1021/ja01632a103 |
| | 2-BIPHENYLYL ISOCYANATE Preparation Products And Raw materials |
|