| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (1S)-(+)-DIMENTHYL SUCCINATE Basic information |
| | (1S)-(+)-DIMENTHYL SUCCINATE Chemical Properties |
| Melting point | 62-64 °C (lit.) | | Boiling point | 200-205 °C/2 mmHg (lit.) | | density | 0.9873 (rough estimate) | | refractive index | 1.4460 (estimate) | | Optical Rotation | [α]20/D +89°, c = 5 in chloroform | | InChI | 1S/C24H42O4/c1-15(2)19-9-7-17(5)13-21(19)27-23(25)11-12-24(26)28-22-14-18(6)8-10-20(22)16(3)4/h15-22H,7-14H2,1-6H3/t17-,18-,19+,20+,21-,22-/m0/s1 | | InChIKey | YZXZAUAIVAZWFN-RBFKZVKLSA-N | | SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OC(=O)CCC(=O)O[C@H]2C[C@@H](C)CC[C@@H]2C(C)C | | LogP | 8.040 (est) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (1S)-(+)-DIMENTHYL SUCCINATE Usage And Synthesis |
| | (1S)-(+)-DIMENTHYL SUCCINATE Preparation Products And Raw materials |
|