| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | (1S)-(+)-MENTHYL ACETATE Basic information |
| | (1S)-(+)-MENTHYL ACETATE Chemical Properties |
| Melting point | <25 °C | | Boiling point | 228-229 °C (lit.) | | density | 0.925 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.446(lit.) | | Fp | 198 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | liquid | | color | Colorless to Almost colorless | | Optical Rotation | [α]/D +78.5±1°, neat | | BRN | 1909419 | | InChI | 1S/C12H22O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h8-9,11-12H,5-7H2,1-4H3/t9-,11+,12-/m0/s1 | | InChIKey | XHXUANMFYXWVNG-WCQGTBRESA-N | | SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OC(C)=O | | CAS DataBase Reference | 5157-89-1 |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 2915.39.9000 | | Storage Class | 10 - Combustible liquids |
| | (1S)-(+)-MENTHYL ACETATE Usage And Synthesis |
| Uses | Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| | (1S)-(+)-MENTHYL ACETATE Preparation Products And Raw materials |
|