- E-4031
-
- $1.00
-
2020-01-14
- CAS:113559-13-0
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 200kg
|
| Product Name: | E-4031 | | Synonyms: | 1-(2-(6-methyl-2-pyridyl)ethyl)-4-(4-methylsulfonylaminobenzoyl)piperidined;methanesulfonamide,n-(4-((1-(2-(6-methyl-2-pyridinyl)ethyl)-4-piperidinyl)carb;E-4031;N-[4-[[1-[2-(6-Methyl-2-pyridinyl)ethyl]-4-piperidinyl]carbonyl]phenyl]methanesulfonamide dihydrochloride;N-[4-[1-[2-(6-Methyl-2-pyridinyl)ethyl]-4-piperidinylcarbonyl]phenyl]methanesulfonamide·2hydrochloric acid;E-4031 (hydrochloride);N-(4-(1-(2-(6-METHYLPYRIDIN-2-YL)ETHYL)PIPERIDINE-4-CARBONYL)PHENYL)METHANESULFONAMIDE 2HCL;N-[4-[1-[2-(6-methylpyridin-2-yl)ethyl]piperidine-4-carbonyl]phenyl]methanesulfonamide dihydrochloride | | CAS: | 113559-13-0 | | MF: | C21H33Cl2N3O5S | | MW: | 510.47 | | EINECS: | | | Product Categories: | Potassium channel;Ion Channels | | Mol File: | 113559-13-0.mol |  |
| | E-4031 Chemical Properties |
| storage temp. | -20°C | | solubility | H2O: soluble | | form | solid | | color | off-white | | Water Solubility | H2O: soluble | | Stability: | Hygroscopic | | InChI | 1S/C21H27N3O3S.2ClH/c1-16-4-3-5-19(22-16)12-15-24-13-10-18(11-14-24)21(25)17-6-8-20(9-7-17)23-28(2,26)27;;/h3-9,18,23H,10-15H2,1-2H3;2*1H | | InChIKey | ZQBNWMFBOSOOLX-UHFFFAOYSA-N | | SMILES | Cl.Cl.Cc1cccc(CCN2CCC(CC2)C(=O)c3ccc(NS(C)(=O)=O)cc3)n1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | E-4031 Usage And Synthesis |
| Uses | E-4031 has been used as:
- human ether-a-go-go-related gene (hERG) blocker in human-induced pluripotent stem cell-derived cardiomyocytes (hiPSC-CMs)
- IKr blocker in long QT syndrome (LQTS) induced pluripotent stem (iPSCs) embryoid bodies
- IKr blocker in rat ventricular myocytes
| | Biological Activity | Selective blocker of hERG K + channels; inhibits the rapid delayed-rectifier K + current (I Kr ). Reversibly prolongs action potential duration in guinea pig papillary muscle and isolated ventricular myocytes, without affecting Na + or Ca 2+ inward currents. Class III antiarrhythmic agent. | | Biochem/physiol Actions | E-4031 is a antiarrhythmic drug and belongs to the class III type. It is a methanesulfonanilide compound and is effective in treating arrhythmia and modulates ventricular fibrillation. E-4031 mediates the prolongation of action potential duration (APD) in transgenic long-QT type 1 (LQT1) rabbits. An isoleucine mutation in human ether-a-go-go-related gene (hERG) abolishes its interaction with E-4031. | | storage | Room temperature (desiccate) |
| | E-4031 Preparation Products And Raw materials |
|