- 2-Amino-3-bromophenol
-
- $10.00 / 1Kg
-
2021-12-10
- CAS:116435-77-9
- Min. Order: 1KG
- Purity: 99.99
- Supply Ability: 500kg/month
- 2-AMINO-3-BROMOPHENOL
-
- $1.00 / 1KG
-
2019-07-06
- CAS:116435-77-9
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 100KG
|
| | 2-AMINO-3-BROMOPHENOL Basic information |
| Product Name: | 2-AMINO-3-BROMOPHENOL | | Synonyms: | 2-AMINO-3-BROMOPHENOL;2-Amino-3-bromophenol 98+%;2-Bromo-6-hydroxyaniline;2-Amino-3-bromophenol 97+%;Phenol, 2-amino-3-bromo-;High quality 2-Amino-3-bromophenol CAS NO.116435-77-9;2-Amino-3-bromophenol CAS NO.116435-77-9;2-amino-3-bromophenol, 98%min | | CAS: | 116435-77-9 | | MF: | C6H6BrNO | | MW: | 188.02 | | EINECS: | | | Product Categories: | | | Mol File: | 116435-77-9.mol |  |
| | 2-AMINO-3-BROMOPHENOL Chemical Properties |
| Melting point | 138℃ | | Boiling point | 266℃ | | density | 1.768 | | Fp | 115℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | powder | | pka | 8.79±0.10(Predicted) | | color | Light brown | | InChI | InChI=1S/C6H6BrNO/c7-4-2-1-3-5(9)6(4)8/h1-3,9H,8H2 | | InChIKey | JBNSVEGZVHJLMS-UHFFFAOYSA-N | | SMILES | C1(O)=CC=CC(Br)=C1N |
| Hazard Codes | T | | HazardClass | IRRITANT | | HS Code | 29222900 |
| | 2-AMINO-3-BROMOPHENOL Usage And Synthesis |
| Uses | 2-Amino-3-bromophenol is a useful reagent for organic synthesis and other chemical processes. | | Synthesis | Step B: Synthesis of 2-amino-3-bromophenol. A dichloromethane solution (10 mL, 10 mmol) of 1.0 M boron tribromide was added slowly and dropwise via syringe to a dichloromethane (30 mL) solution of 6-bromo-2-methoxyaniline (1.01 g, 5 mmol) under cooling conditions in an ice bath. The reaction mixture was slowly warmed to room temperature and stirred continuously overnight. Upon completion of the reaction, the reaction was quenched by the addition of methanol (10 mL) and the solvent was subsequently removed by rotary evaporator to afford the target product 2-amino-3-bromophenol (0.87 g, 92% yield). | | References | [1] Patent: US6291511, 2001, B1 |
| | 2-AMINO-3-BROMOPHENOL Preparation Products And Raw materials |
|