1,2,3,4-Tetrachlorohexafluorobutane manufacturers
|
| | 1,2,3,4-Tetrachlorohexafluorobutane Basic information |
| Product Name: | 1,2,3,4-Tetrachlorohexafluorobutane | | Synonyms: | 1,2,3,4-TETRACHLOROHEXAFLUOROBUTANE;Hexafluoro-1,2,3,4-tetrachlorobutane 97%;Hexafluoro-1,2,3,4-tetrachlorobutane97%;1,2,3,4-Tetrafluorohexafluorobutane;1,2,3,4-Tetrachloro-1,1,2,3,4,4-hexafluorobutane;Perfluoro-1,2,3,4-tetrachlorobutane, 1,1,2,3,4,4-Hexafluoro-1,2,3,4-tetrachlorobutane;Butane,1,2,3,4-tetrachloro-1,1,2,3,4,4-hexafluoro-;1,2,3,4-Tetrachlorohexafluoro | | CAS: | 375-45-1 | | MF: | C4Cl4F6 | | MW: | 303.85 | | EINECS: | 938-148-1 | | Product Categories: | | | Mol File: | 375-45-1.mol |  |
| | 1,2,3,4-Tetrachlorohexafluorobutane Chemical Properties |
| Boiling point | 134-135°C | | density | 1.72[at 20℃] | | form | liquid | | color | Clear, colourless | | InChI | InChI=1S/C4Cl4F6/c5-1(9,3(7,11)12)2(6,10)4(8,13)14 | | InChIKey | IRHYACQPDDXBCB-UHFFFAOYSA-N | | SMILES | C(Cl)(F)(F)C(Cl)(F)C(Cl)(F)C(Cl)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HazardClass | IRRITANT | | HS Code | 2903779090 |
| | 1,2,3,4-Tetrachlorohexafluorobutane Usage And Synthesis |
| Uses | 1,2,3,4-tetrachloro-hexafluoro-butane, also known as A316, is used as an intermediate compound in the synthesis of hexafluoro-1,3-butadiene (also known as C4F6 or HFBD), a stable gas which is used in the semiconductor industry, in particular as etching gas for semiconductor fine processing.
| | Flammability and Explosibility | Non flammable | | References | [1] Emanuela, Antenucci , et al. "PROCESSES FOR THE SYNTHESIS OF 1,2,3,4-TETRACHLORO-HEXAFLUORO-BUTANE.", WO2016193248A1.
|
| | 1,2,3,4-Tetrachlorohexafluorobutane Preparation Products And Raw materials |
|