| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Magnesium L-glutamate tetrahydrate manufacturers
|
| | Magnesium L-glutamate tetrahydrate Basic information |
| Product Name: | Magnesium L-glutamate tetrahydrate | | Synonyms: | MONOMAGNESIUM DI-L-GLUTAMATE TETRAHYDRATE;MG L-GLU2 4H2O;L-GLUTAMIC ACID HEMIMAGNESIUM SALT TETRAHYDRATE;MAGNESIUM DI-L-GLUTAMATE;MAGNESIUM-L-GLUTAMATE;MAGNESIUML-GLUTAMATE4-HYDRATE;L-Glutamic acid tetrahydrate hemimagnesium salt;MAGNESIUM-L-GLUTAMATE 99% | | CAS: | 18543-68-5 | | MF: | C10H13MgN2O8- | | MW: | 313.53 | | EINECS: | 242-413-0 | | Product Categories: | | | Mol File: | 18543-68-5.mol |  |
| | Magnesium L-glutamate tetrahydrate Chemical Properties |
| Melting point | 130-135 °C (dec.) | | form | solid | | Odor | at 100.00%. odorless | | Major Application | peptide synthesis | | InChI | InChI=1S/2C5H8NO4.Mg/c2*6-3(5(9)10)1-2-4(7)8;/h2*3,6H,1-2H2,(H,7,8)(H,9,10);/q2*-1;+4/p-3 | | InChIKey | ULYWDUYCXFQFEU-UHFFFAOYSA-K | | SMILES | C(C1C([O-][Mg+2]2([O-]C(=O)C(CCC(=O)[O-])N2)N1)=O)CC(=O)[O-].[H+] | | LogP | -1.435 (est) |
| WGK Germany | 2 | | RTECS | MA1413000 | | Storage Class | 11 - Combustible Solids |
| | Magnesium L-glutamate tetrahydrate Usage And Synthesis |
| Chemical Properties | White or nearly white crystals or powder, odorless, with a special taste. Very soluble in water, insoluble in ethanol. | | Uses | L-Glutamic acid hemimagnesium salt tetrahydrate is a magnesium transfer agent/carrier. It can also be used in the preparation of S30A buffer solution. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Magnesium L-glutamate tetrahydrate Preparation Products And Raw materials |
|