| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Glycidaldehyde diethylacetal Basic information |
| | Glycidaldehyde diethylacetal Chemical Properties |
| Boiling point | 60-64 °C(Press: 13 Torr) | | density | 0.943 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.414(lit.) | | Fp | 126 °F | | storage temp. | Storage temp. 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C7H14O3/c1-3-8-7(9-4-2)6-5-10-6/h6-7H,3-5H2,1-2H3 | | InChIKey | QIQQWSQARNQPLP-UHFFFAOYSA-N | | SMILES | O1CC1C(OCC)OCC | | CAS DataBase Reference | 13269-77-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 10-37/38-41 | | Safety Statements | 16-26-36/37/39 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Dam. 1
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | Glycidaldehyde diethylacetal Usage And Synthesis |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 26, p. 659, 1961 DOI: 10.1021/jo01062a004 |
| | Glycidaldehyde diethylacetal Preparation Products And Raw materials |
|