(2R,5S)-2,5-Dimethyl-piperazine-1-carboxylic acid tert-butyl ester manufacturers
|
| | (2R,5S)-2,5-Dimethyl-piperazine-1-carboxylic acid tert-butyl ester Basic information |
| Product Name: | (2R,5S)-2,5-Dimethyl-piperazine-1-carboxylic acid tert-butyl ester | | Synonyms: | TERT-BUTYL(2R,5S)-2,5-DIMETHYLPIPERAZINE-1-CARBOXYLATE;2,5-DiMethyl-piperazine-1-carboxylic acid tert-butyl ester;(2R,5S)-N-(tert-butyl)-2,5-dimethyl-1-piperazinecarboxamide;(2R,5S)-1-N-Boc-2,5-dimethylpiperazine;(2R,5S)-N-(1,1-Dimethylethyl)-2,5-dimethyl-1-piperazinecarboxamide;(2R,5S)-Tert-Butyl 2,5-Dimethylpiperazine;(2R,5S-TERT-BUTYL 2,5-DIMETHYLPIPERAZINE;(2R,5S)-2,5-Dimethylpiperazine, N1-Boc protected | | CAS: | 309915-46-6 | | MF: | C11H22N2O2 | | MW: | 214.31 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | (2R,5S)-2,5-Dimethyl-piperazine-1-carboxylic acid tert-butyl ester Chemical Properties |
| Boiling point | 280℃ | | density | 0.970 | | Fp | 123℃ | | storage temp. | 2-8°C(protect from light) | | pka | 8.55±0.60(Predicted) | | form | solid | | color | Colourless to light yellow / liquid | | InChI | InChI=1S/C11H22N2O2/c1-8-7-13(9(2)6-12-8)10(14)15-11(3,4)5/h8-9,12H,6-7H2,1-5H3/t8-,9+/m0/s1 | | InChIKey | PGZCVLUQTJRRAA-DTWKUNHWSA-N | | SMILES | N1(C(OC(C)(C)C)=O)C[C@H](C)NC[C@H]1C |
| | (2R,5S)-2,5-Dimethyl-piperazine-1-carboxylic acid tert-butyl ester Usage And Synthesis |
| Uses | As an organic intermediate, (2R,5S)-2,5-DiMethyl-piperazine-1-carboxylic acid tert-butyl ester is mainly used in organic synthesis and scientific research.
| | Synthesis | Tert-butyl 4-(4-fluorobenzyl)-(2R,5S)-dimethylpiperazine-1-carboxylate (37.8 g, 117.4 mmol) was used as a raw material and dissolved in a mixture of methanol (250 mL) and glacial acetic acid (30 mL). The mixture was transferred to a 2 L hydrogenation flask, purged with nitrogen and stirred for 10 min. Subsequently, palladium hydroxide (3.8 g, 20 wt%) was added to the mixture and the reaction was shaken at room temperature and 40 psi hydrogen pressure for 48 hours. After completion of the reaction, the reaction mixture was filtered through diatomaceous earth and washed with methanol. The filtrate was concentrated to dryness on a rotary evaporator to afford 37.64 g (100% yield) of the target product (2R,5S)-tert-butyl (2R,5-Dimethylpiperazine-1-carboxylate), which was detected by mass spectrometry showing the M+H+ peak at 215. | | References | [1] Patent: US2004/142940, 2004, A1. Location in patent: Page/Page column 29 [2] Patent: US2004/142940, 2004, A1. Location in patent: Page/Page column 44-45 [3] Bioorganic and Medicinal Chemistry Letters, 2010, vol. 20, # 3, p. 828 - 831 |
| | (2R,5S)-2,5-Dimethyl-piperazine-1-carboxylic acid tert-butyl ester Preparation Products And Raw materials |
|