| Company Name: |
Pharmavoyager Gold |
| Tel: |
15351203386 |
| Email: |
2592141051@qq.com |
(2R,5S)-tert-Butyl 2,5-diMethylpiperazine-1-carboxylate hydrochloride manufacturers
|
| | (2R,5S)-tert-Butyl 2,5-diMethylpiperazine-1-carboxylate hydrochloride Basic information |
| Product Name: | (2R,5S)-tert-Butyl 2,5-diMethylpiperazine-1-carboxylate hydrochloride | | Synonyms: | (2R,5S)-1-N-BOC-2,5-dimethylpiperazine hydrochloride;(2R,5S)-1-Boc-2,5-diMethylpiperazine-HCl;(2R,5S)-1-Boc-2,5-diMethylpiperazine hydrochloride;tert-butyl (2R,5S)-rel-2,5-dimethylpiperazine-1-carboxylate hydrochloride;tert-butyl trans-2,5-dimethylpiperazine-1-carboxylate hydrochloride;TERT-BUTYL TRANS-2,5-DIMETHYLPIPERAZINE-1-CARBOXYLATE HCL;(2R,5S)-Tert-Butyl 2,5-Dimethylpiperazine-1-Car;(2R,5S-TERT-BUTYL 2,5-DIMETHYLPIPERAZINE-1-CAR | | CAS: | 792969-69-8 | | MF: | C11H22N2O2.ClH | | MW: | 250.77 | | EINECS: | | | Product Categories: | | | Mol File: | 792969-69-8.mol |  |
| | (2R,5S)-tert-Butyl 2,5-diMethylpiperazine-1-carboxylate hydrochloride Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1/C11H22N2O2.ClH/c1-8-7-13(9(2)6-12-8)10(14)15-11(3,4)5;/h8-9,12H,6-7H2,1-5H3;1H/t8-,9+;/s3 | | InChIKey | TWALJKZSNHQOBH-HLRUTPIHNA-N | | SMILES | C(N1C[C@H](C)NC[C@H]1C)(=O)OC(C)(C)C.Cl |&1:3,7,r| |
| | (2R,5S)-tert-Butyl 2,5-diMethylpiperazine-1-carboxylate hydrochloride Usage And Synthesis |
| | (2R,5S)-tert-Butyl 2,5-diMethylpiperazine-1-carboxylate hydrochloride Preparation Products And Raw materials |
|