|
|
| | 2,6-DIMETHYLNAPHTHALENE Basic information |
| | 2,6-DIMETHYLNAPHTHALENE Chemical Properties |
| Melting point | 106-110 °C (lit.) | | Boiling point | 262 °C (lit.) | | density | 1.01 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.6088(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | almost transparency in Toluene | | form | powder to crystal | | color | White to Almost white | | Water Solubility | 2mg/L(25 ºC) | | BRN | 1903544 | | InChI | InChI=1S/C12H12/c1-9-3-5-12-8-10(2)4-6-11(12)7-9/h3-8H,1-2H3 | | InChIKey | YGYNBBAUIYTWBF-UHFFFAOYSA-N | | SMILES | C1=C2C(C=C(C)C=C2)=CC=C1C | | LogP | 4.310 | | CAS DataBase Reference | 581-42-0(CAS DataBase Reference) | | EPA Substance Registry System | 2,6-Dimethylnaphthalene (581-42-0) |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 22-24/25-61-60 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2902.90.9000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| | 2,6-DIMETHYLNAPHTHALENE Usage And Synthesis |
| Uses | 2,6-Dimethylnaphthalene hs been used as a substrate in intramolecular isotope effect experiments to compare substrate dynamics in CYP2E1 and CYP2A6. | | Definition | ChEBI: A dimethylnaphthalene carrying methyl groups at positions 2 and 6. | | General Description | 2,6-dimethylnaphthalene is a polycyclic aromatic hydrocarbon available in the water bodies and can be determined by gas chromatography with flame-ionization. | | Purification Methods | Distil it in steam and crystallise it from EtOH. [Beilstein 5 IV 1714.] |
| | 2,6-DIMETHYLNAPHTHALENE Preparation Products And Raw materials |
|