| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
4,4'-Dimethylthiocarbanilide manufacturers
|
| | 4,4'-Dimethylthiocarbanilide Basic information |
| Product Name: | 4,4'-Dimethylthiocarbanilide | | Synonyms: | 4,4’-dimethylthio-carbanilid;usafek-3114;RARECHEM AQ A4 0039;N,N'-DI (P-TOLYL)-2-THIOUREA;N,N'-DI-P-TOLYLTHIOUREA;1,3-DI(P-TOLYL)THIOUREA;1,3-DI-P-TOLYL-2-THIOUREA;N,N'-Di-p-tolyl-thioura | | CAS: | 621-01-2 | | MF: | C15H16N2S | | MW: | 256.37 | | EINECS: | 210-665-0 | | Product Categories: | | | Mol File: | 621-01-2.mol |  |
| | 4,4'-Dimethylthiocarbanilide Chemical Properties |
| Melting point | 182-184 °C (lit.) | | Boiling point | 377.7±45.0 °C(Predicted) | | density | 1.219±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 12.34±0.70(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | InChI | 1S/C15H16N2S/c1-11-3-7-13(8-4-11)16-15(18)17-14-9-5-12(2)6-10-14/h3-10H,1-2H3,(H2,16,17,18) | | InChIKey | ULNVBRUIKLYGDF-UHFFFAOYSA-N | | SMILES | Cc1ccc(NC(=S)Nc2ccc(C)cc2)cc1 | | CAS DataBase Reference | 621-01-2(CAS DataBase Reference) |
| WGK Germany | 3 | | RTECS | FE0875000 | | HS Code | 2930.90.2900 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 4,4'-Dimethylthiocarbanilide Usage And Synthesis |
| Uses | 1,3-Di-p-tolyl-2-thiourea may be used in chemical synthesis studies. |
| | 4,4'-Dimethylthiocarbanilide Preparation Products And Raw materials |
|