|
|
| | 2-Ethoxy-4-amino-5-chlorobenzoic acid Basic information |
| | 2-Ethoxy-4-amino-5-chlorobenzoic acid Chemical Properties |
| Melting point | 165-169°C | | Boiling point | 377.7±42.0 °C(Predicted) | | density | 1.376±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.50±0.10(Predicted) | | color | White to Light Yellow | | InChI | InChI=1S/C9H10ClNO3/c1-2-14-8-4-7(11)6(10)3-5(8)9(12)13/h3-4H,2,11H2,1H3,(H,12,13) | | InChIKey | XWGYOMHQGQZRLC-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(Cl)=C(N)C=C1OCC | | CAS DataBase Reference | 108282-38-8(CAS DataBase Reference) |
| | 2-Ethoxy-4-amino-5-chlorobenzoic acid Usage And Synthesis |
| Chemical Properties | White or almost white powder | | Uses | Methyl 4-Amino-5-chloro-2-methoxybenzoate is used in preparation of phenoxymethylpyridine derivatives as immunomodulators. | | Synthesis Reference(s) | Chemical and Pharmaceutical Bulletin, 19, p. 1696, 1971 DOI: 10.1248/cpb.19.1696 |
| | 2-Ethoxy-4-amino-5-chlorobenzoic acid Preparation Products And Raw materials |
|