|
|
| | MAGNESIUM METHACRYLATE Basic information |
| Product Name: | MAGNESIUM METHACRYLATE | | Synonyms: | METHACRYLIC ACID, MAGNESIUM SALT;MAGNESIUM METHACRYLATE;MAGNESIUM DIMETHACRYLATE;Magnesium Methylacrylate;Bismethacrylic acid magnesium salt;Dimethacrylic acid magnesium salt;Methacrylic acid magnesium;San Ester SK 13 | | CAS: | 7095-16-1 | | MF: | C8H10MgO4 | | MW: | 194.47 | | EINECS: | 230-402-3 | | Product Categories: | | | Mol File: | 7095-16-1.mol |  |
| | MAGNESIUM METHACRYLATE Chemical Properties |
| Melting point | 490°C | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | InChI=1S/2C4H6O2.Mg/c2*1-3(2)4(5)6;/h2*1H2,2H3,(H,5,6);/q;;+2/p-2 | | InChIKey | DZBOAIYHPIPCBP-UHFFFAOYSA-L | | SMILES | C(=O)(O[Mg]OC(=O)C(=C)C)C(=C)C |
| | MAGNESIUM METHACRYLATE Usage And Synthesis |
| Uses | MAGNESIUM METHACRYLATE can improve the crosslinking properties of rubber. |
| | MAGNESIUM METHACRYLATE Preparation Products And Raw materials |
|