| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-Methyl-2-pentanone-1,1,1,3,3-d5 Basic information |
| Product Name: | 4-Methyl-2-pentanone-1,1,1,3,3-d5 | | Synonyms: | 4-METHYL-2-PENTANONE-1,1,1,3,3-D5, 98 AT OM % D;1,1,1,3,3-pentadeuterio-4-methyl-pentan-2-one;1,1,1,3,3-pentadeuterio-4-methylpentan-2-one;4-Methyl-2-pentanone--d5;Deuterated 4-methyl-2-pentanone;Deuterated methyl isobutyl ketone;Isopropylacetone-D5;2-Pentanone， 4-methyl-1，1，1，3，3-[D5 | | CAS: | 4840-81-7 | | MF: | C6H12O | | MW: | 100.16 | | EINECS: | | | Product Categories: | Alphabetical Listings;M;Stable Isotopes | | Mol File: | 4840-81-7.mol |  |
| | 4-Methyl-2-pentanone-1,1,1,3,3-d5 Chemical Properties |
| Melting point | −80 °C(lit.) | | Boiling point | 117-118 °C (lit.) | | density | 0.841 g/mL at 25 °C | | refractive index | n20/D 1.396(lit.) | | Fp | 56 °F | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) Water (Slightly) | | form | Oil | | color | Colourless | | InChI | 1S/C6H12O/c1-5(2)4-6(3)7/h5H,4H2,1-3H3/i3D3,4D2 | | InChIKey | NTIZESTWPVYFNL-IKISXXDZSA-N | | SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])C(C)C |
| Hazard Codes | F,Xn | | Risk Statements | 11-20/21/22-36/37/38-36/37-20 | | Safety Statements | 16-26-33-36/37/39 | | RIDADR | UN 1245 3/PG 2 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Inhalation
Carc. 2 Inhalation
Eye Irrit. 2
Flam. Liq. 2
STOT SE 3 |
| | 4-Methyl-2-pentanone-1,1,1,3,3-d5 Usage And Synthesis |
| Uses | 4-Methyl-2-pentanone-d5 is the isotope labelled analog of 4-Methyl-3-pentanone (M328025), a reactant used to synthesize 2-(1-Hydroxy-3-methylbutylidene)-1H-indene-1,3(2H)-dione (H953650). |
| | 4-Methyl-2-pentanone-1,1,1,3,3-d5 Preparation Products And Raw materials |
|