| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | D-[2-13C]MANNITOL Basic information |
| | D-[2-13C]MANNITOL Chemical Properties |
| Melting point | 167-170 °C(lit.) | | storage temp. | Refrigerator | | solubility | Water (Slightly) | | form | Solid | | color | White | | Optical Rotation | [α]25/D +141°, c = 0.4 in acidified ammonium molybdate | | InChI | 1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5-,6-/m1/s1/i3+1 | | InChIKey | FBPFZTCFMRRESA-ZRXDASGMSA-N | | SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[13C@H](O)CO | | CAS Number Unlabeled | 69-65-8 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | D-[2-13C]MANNITOL Usage And Synthesis |
| Uses | (D-[2-13c]Mannitol) Labeled D-Mannitol is widespread in plants and plant exudates; obtained from manna and seaweeds. D-Mannitol is used in the food industry as anticaking and free-flow agent, flavoring agent, lubricant and release agent, stabilizer and thickener and nutritive sweetener. |
| | D-[2-13C]MANNITOL Preparation Products And Raw materials |
|