|
|
| | 1,3-DIPROPYL-8-P-SULFOPHENYLXANTHINE Basic information |
| Product Name: | 1,3-DIPROPYL-8-P-SULFOPHENYLXANTHINE | | Synonyms: | 1,3-DIPROPYL-8-P-SULFOPHENYLXANTHINE;1,3-dipropyl-8-(4-sulfophenyl)xanthine;4-[(1,3-Dipropyl-2,6-dioxo-2,3,6,7-tetrahydro-1H-purin)-8-yl]benzenesulfonic acid;8-(p-Sulfophenyl)-1,3-dipropylxanthine;DPSPX;NAPS-BIOTINYL DIHYCROCHLORIDE (RBIOPROBE ) N(D-BIOTINYLAMINOPHEN;1,3-DIPROPYL-8-P-SULFOPHENYLXANTHINE WAT ER SOLUBLE ADENOSI;4-(2,3,6,7-Tetrahydro-2,6-dioxo-1,3-dipropyl-1H-purin-8-yl)benzenesulfonic Acid | | CAS: | 89073-57-4 | | MF: | C17H20N4O5S | | MW: | 392.43 | | EINECS: | | | Product Categories: | Aromatics;Heterocycles;Sulfur & Selenium Compounds;All Inhibitors;Inhibitors;Adenosines/P2 Nucleotide Receptors (Purinergics);Antagonists;Neurotransmitters | | Mol File: | 89073-57-4.mol |  |
| | 1,3-DIPROPYL-8-P-SULFOPHENYLXANTHINE Chemical Properties |
| Melting point | >300°C | | density | 1.3115 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Refrigerator | | solubility | H2O: 0.43 mg/mL | | form | solid | | pka | -1.59±0.50(Predicted) | | color | white | | Water Solubility | 1.3g/L(temperature not stated) | | Stability: | Store tightly sealed at RT; Solutions stable at 4 °C for several days | | InChI | 1S/C17H20N4O5S/c1-3-9-20-15-13(16(22)21(10-4-2)17(20)23)18-14(19-15)11-5-7-12(8-6-11)27(24,25)26/h5-8H,3-4,9-10H2,1-2H3,(H,18,19)(H,24,25,26) | | InChIKey | IWALGNIFYOBRKC-UHFFFAOYSA-N | | SMILES | CCCN1C(=O)N(CCC)c2nc([nH]c2C1=O)-c3ccc(cc3)S(O)(=O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 1,3-DIPROPYL-8-P-SULFOPHENYLXANTHINE Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Water soluble adenosine receptor antagonist with slight selectivity for A1 receptors. | | Biological Activity | Water soluble adenosine receptor antagonist with slight selectivity for A1 receptors. |
| | 1,3-DIPROPYL-8-P-SULFOPHENYLXANTHINE Preparation Products And Raw materials |
|