| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Cyclohexylurea
-
- $1.00
-
2020-01-01
- CAS: 698-90-8
- Min. Order: 1KG
- Purity: 95-99%
- Supply Ability: 1ton
|
| | Cyclohexylurea Basic information |
| | Cyclohexylurea Chemical Properties |
| Melting point | 194-196°C | | Boiling point | 240.3±13.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | pka | 13.97±0.20(Predicted) | | form | powder to crystal | | color | White to Almost white | | BRN | 636914 | | InChI | InChI=1S/C7H14N2O/c8-7(10)9-6-4-2-1-3-5-6/h6H,1-5H2,(H3,8,9,10) | | InChIKey | WUESWDIHTKHGQA-UHFFFAOYSA-N | | SMILES | N(C1CCCCC1)C(N)=O | | CAS DataBase Reference | 698-90-8(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | RTECS | YS7564300 | | HS Code | 2924210090 |
| Provider | Language |
|
ALFA
| English |
| | Cyclohexylurea Usage And Synthesis |
| Uses | Cyclohexylurea can be used as a raw material in organic synthesis for the preparation of 2-chloro-N-(cyclohexylcarbamoyl)acetamide. |
| | Cyclohexylurea Preparation Products And Raw materials |
|