|
|
| | Perfluorododecanoic acid Basic information |
| Product Name: | Perfluorododecanoic acid | | Synonyms: | tricosafluoro-dodecanoicaci;TRICOSAFLUORODODECANOIC ACID;PERFLUORODODECANOIC ACID;PERFLUOROLAURIC ACID;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-Tricosafluorododecanoic acid;Perfluorododecanoic acid,97%;Tricosafluorododecanoic acid,Perfluorododecanoic acid, Perfluorolauric acid;Perfluorododecanoic Acid
Tricosafluorolauric Acid
Perfluorolauric Acid | | CAS: | 307-55-1 | | MF: | C12HF23O2 | | MW: | 614.1 | | EINECS: | 206-203-2 | | Product Categories: | | | Mol File: | 307-55-1.mol |  |
| | Perfluorododecanoic acid Chemical Properties |
| Melting point | 105-108 °C (lit.) | | Boiling point | 245 °C/740 mmHg (lit.) | | density | 1.7633 (estimate) | | Fp | 245°C | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly, Heated), Methanol (Slightly) | | form | Solid | | pka | 0.52±0.10(Predicted) | | color | white powder or chunks | | BRN | 1811257 | | Henry's Law Constant | 6.4×10-3 mol/(m3Pa) at 25℃, Plassmann et al. (2011) | | InChI | InChI=1S/C12HF23O2/c13-2(14,1(36)37)3(15,16)4(17,18)5(19,20)6(21,22)7(23,24)8(25,26)9(27,28)10(29,30)11(31,32)12(33,34)35/h(H,36,37) | | InChIKey | CXGONMQFMIYUJR-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 307-55-1(CAS DataBase Reference) | | EPA Substance Registry System | Perfluorododecanoic acid (307-55-1) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 3261 | | WGK Germany | 3 | | RTECS | JR3740000 | | Hazard Note | Corrosive | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29159000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Lact. Repr. 1B STOT RE 1 |
| | Perfluorododecanoic acid Usage And Synthesis |
| Chemical Properties | Perfluorododecanoic acid (PFDoA, tricosafluorododecanoic acid, perfluoric acid, tricosafluorolauric acid) exists as solid white, fine crystals. Perfluorododecanoic acid may be incompatible with strong oxidizers. Upon decomposition, PFDoA can form carbon monoxide, carbon dioxide, and hydrogen fluoride. | | uses | Perfluorododecanoic acid is a twelve-carbon compound in the perfluoroalkyl family of chemicals. It is a byproduct of stain- and greaseproof coatings on food packages, furniture, and carpets. It is known to bioaccumulate in the environment, although research related to the toxicity of the chemical is scarce. | | Definition | ChEBI: A fluoroalkanoic acid that is dodecanoic acid in which all of the hydrogens attached to carbon atoms are replaced by fluorines. It is a highly persistent, bioaccumulative breakdown product of stain- and grease-proof coatings on food packaging, soft furnish
ngs and carpets. |
| | Perfluorododecanoic acid Preparation Products And Raw materials |
|