|
|
| | L-Proline-2,5,5-d3 Basic information |
| Product Name: | L-Proline-2,5,5-d3 | | Synonyms: | L-PROLINE (2,5,5-D3, 98%);2-Pyrrolidinecarboxylic acid-[D3;L-Proline-2,5,5-d3 in 0.1 M HCl;L-Proline-2,5,5-d3;D3-L-Proline;L-Proline (2,5,5-D?, 98%);L-Proline-D3 (Standard);(S)-Pyrrolidine-2-carboxylic-2,5,5-d3 acid | | CAS: | 65807-22-9 | | MF: | C5H9NO2 | | MW: | 115.13 | | EINECS: | | | Product Categories: | | | Mol File: | 65807-22-9.mol |  |
| | L-Proline-2,5,5-d3 Chemical Properties |
| Melting point | >185°C (dec.) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | Pale Yellow to Light Yellow | | Water Solubility | Water: slightly soluble | | InChI | 1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m1/s1/i3D2,4D | | InChIKey | ONIBWKKTOPOVIA-LTDLRDEHSA-N | | SMILES | [2H]C1([2H])CC[C@]([2H])(C(O)=O)N1 | | CAS Number Unlabeled | 147-85-3 |
| WGK Germany | 1 | | Storage Class | 11 - Combustible Solids |
| | L-Proline-2,5,5-d3 Usage And Synthesis |
| Uses | L-Proline-2,5,5-d3 is the labelled form of L-Proline, which is an amino acid and precursor (with vitamin C) for collagen. L-Proline is the building block of the structure of tendons, ligaments, arteries, veins and muscles. It is important in wound healing. |
| | L-Proline-2,5,5-d3 Preparation Products And Raw materials |
|