| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:L-Methionine-d3
CAS:13010-53-2
Package:100Mg,10Mg
|
|
| | L-METHIONINE-METHYL-D3 Basic information |
| | L-METHIONINE-METHYL-D3 Chemical Properties |
| Melting point | 273 °C (dec.)(lit.) | | storage temp. | Refrigerator | | solubility | Aqueous Acid (Sparingly), Water (Slightly, Heated) | | form | Solid | | color | White to Off-White | | Appearance | white powder | | Optical Rotation | [α]25/D +23.1°, c = 1 in 1 M HCl &_& [α]25/D +23.1°, c = 1 in 1 M HCl | | InChI | 1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1/i1D3 | | InChIKey | FFEARJCKVFRZRR-OSIBIXDNSA-N | | SMILES | [2H]C([2H])([2H])SCC[C@H](N)C(O)=O | | CAS Number Unlabeled | 63-68-3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-METHIONINE-METHYL-D3 Usage And Synthesis |
| Description | L-methionine (S-methyl-d3) is the deuterium labeled amino acid with application in labeling for NMR spectroscopy and research of proteins and peptides structure and dynamics. | | Chemical Properties | White Solid | | Uses | Labelled L-Methionine (M260440). Essential aminoacid for human development. Hepatoprotectant; antidote (acetominophen poisoning); urinary acidifier. | | Definition | ChEBI: L-methionine-d3 is a L-methionine and a deuterated compound. |
| | L-METHIONINE-METHYL-D3 Preparation Products And Raw materials |
|