| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:(±)-1,4-Dithiothreitol-d10
CAS:302912-05-6
Remarks:CS-C-00265
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:DL-Dithiothreitol-d10
CAS:302912-05-6
Purity:98 atom % D, 98% (CP) Package:500MG Remarks:485535-500MG
|
| Company Name: |
Nanjing Haolv Biotechnology Co.,Ltd
|
| Tel: |
025-84622273 17361806303 |
| Email: |
kexin.zhou@haolvbiotech.com |
| Products Intro: |
Product Name:(±)-1,4-Dithiothreitol-d10
CAS:302912-05-6
Remarks:Buffers and Reagents
|
|
| | 1,4-DITHIOTHREITOL-D10 Basic information |
| Product Name: | 1,4-DITHIOTHREITOL-D10 | | Synonyms: | 1,1,2,3,4,4-hexadeuterio-2,3-dideuteriooxy-1,4-bis(deuteriosulfanyl)butane;DL-1,4-DITHIOTHREITOL (D10);1,4-DITHIOTHREITOL-D10, 98 ATOM % D;cleland's reagent-d10;dl-dithiothreitol-d10;1,4-DITHIOTHREITOL-D10;DL-Dithiothreitol-d10 98 atom % D, 98% (CP);DL-Dithiothreitol-d?? | | CAS: | 302912-05-6 | | MF: | C4D10O2S2 | | MW: | 164.31 | | EINECS: | | | Product Categories: | | | Mol File: | 302912-05-6.mol |  |
| | 1,4-DITHIOTHREITOL-D10 Chemical Properties |
| Melting point | 42-44 °C(lit.) | | Boiling point | 364.453±42.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.303±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 9.283±0.10(predicted) | | InChI | 1S/C4H10O2S2/c5-3(1-7)4(6)2-8/h3-8H,1-2H2/i1D2,2D2,3D,4D,5D,6D/hD2 | | InChIKey | VHJLVAABSRFDPM-BSSDICLPSA-N | | SMILES | [2H]OC([2H])(C([2H])([2H])S[2H])C([2H])(O[2H])C([2H])([2H])S[2H] | | CAS Number Unlabeled | 27565-41-9 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3 |
| | 1,4-DITHIOTHREITOL-D10 Usage And Synthesis |
| Uses | DL-dithiothreitol-d10 is the deuterated form of DL-dithiothreitol. DL-dithiothreitol (DTT) is a strong reductant with anti-disulfidptosis activity. When DL-dithiothreitol is oxidized, it forms a stable six-membered ring with an internal disulfide bond[1][2]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019 Feb;53(2):211-216. DOI:10.1177/1060028018797110
[2] Yao H, et al. Establishment of disulfidptosis-related LncRNA signature as biomarkers in colon adenocarcinoma[J]. Cancer Cell International, 2024, 24(1): 183. DOI:10.1186/s12935-024-03374-6 |
| | 1,4-DITHIOTHREITOL-D10 Preparation Products And Raw materials |
|