- TRIUNDECANOIN
-
-
2026-06-30
- CAS:13552-80-2
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
|
| | TRIUNDECANOIN Basic information | | Uses |
| Product Name: | TRIUNDECANOIN | | Synonyms: | triundecylin;undecanoicacid,1,2,3-propanetriylester;AKOMED C;1,2,3-TRIUNDECANOYLGLYCEROL;GLYCERYL TRIUNDECANOATE;GLYCEROL TRIUNDECANOATE;HENDECANOIN;C11:0 | | CAS: | 13552-80-2 | | MF: | C36H68O6 | | MW: | 596.92 | | EINECS: | 236-935-8 | | Product Categories: | | | Mol File: | 13552-80-2.mol |  |
| | TRIUNDECANOIN Chemical Properties |
| Melting point | 24-32 °C | | Boiling point | 611.6±22.0 °C(Predicted) | | density | 0.942±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | biological source | synthetic | | BRN | 1810343 | | Cosmetics Ingredients Functions | SKIN CONDITIONING
HAIR CONDITIONING | | InChI | InChI=1S/C36H68O6/c1-4-7-10-13-16-19-22-25-28-34(37)40-31-33(42-36(39)30-27-24-21-18-15-12-9-6-3)32-41-35(38)29-26-23-20-17-14-11-8-5-2/h33H,4-32H2,1-3H3 | | InChIKey | MBXVIRZWSHICAV-UHFFFAOYSA-N | | SMILES | C(OC(=O)CCCCCCCCCC)C(OC(=O)CCCCCCCCCC)COC(=O)CCCCCCCCCC | | LogP | 13.972 (est) | | EPA Substance Registry System | Undecanoic acid, 1,2,3-propanetriyl ester (13552-80-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | YQ2581000 | | TSCA | TSCA listed | | HS Code | 29157090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | TRIUNDECANOIN Usage And Synthesis |
| Uses | Triundecanoin is a component of hair tonics for promoting hair growth. | | Description | 1,2,3-Triundecanoyl glycerol is a triacylglycerol that contains undecanoic acid at the sn-1, sn-2, and sn-3 positions. Dietary administration of a 7:3 (w/w) mixture of 1,2,3-triundecanoyl glycerol and corn oil prevents fasting-induced decreases in plasma glucose, alanine, and insulin levels, as well as the ratio of insulin to glucagon, in rats compared with dietary administration of corn oil alone. | | Chemical Properties | white tacky mass | | Uses | Triundecanoin is a component of hair tonics for promoting hair growth. | | Definition | ChEBI: Glycerol triundecanoate is a triglyceride. | | References | [1] F X PI-SUNYER. Glucagon, insulin, and gluconeogenesis in fasted odd carbon fatty acid-enriched rats.[J]. American Journal of Physiology, 1976, 231 2: 366-369. DOI: 10.1152/ajplegacy.1976.231.2.366 |
| | TRIUNDECANOIN Preparation Products And Raw materials |
|