|
|
| | S-tert-Butylmercapto-l-cysteine Basic information |
| | S-tert-Butylmercapto-l-cysteine Chemical Properties |
| Melting point | 177 °C (dec.)(lit.) | | Boiling point | 324.7±37.0 °C(Predicted) | | density | 1.225 | | storage temp. | 2-8°C | | pka | 2.03±0.10(Predicted) | | form | Solid | | color | White to off-white | | BRN | 2247500 | | Major Application | peptide synthesis | | InChI | InChI=1S/C7H15NO2S2/c1-7(2,3)12-11-4-5(8)6(9)10/h5H,4,8H2,1-3H3,(H,9,10)/t5-/m0/s1 | | InChIKey | TWMBHZTWEDJDRC-YFKPBYRVSA-N | | SMILES | C(O)(=O)[C@H](CSSC(C)(C)C)N | | CAS DataBase Reference | 30044-51-0(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 13 | | HS Code | 2930901600 | | Storage Class | 11 - Combustible Solids |
| | S-tert-Butylmercapto-l-cysteine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | S-tert-butylmercapto-L-cysteine may be used to introduce synthetically useful S-tert-butylthio groups into peptides. | | Biological Activity | S-tert-Butylmercapto-L-cysteine is a cysteine derivative. it is may be used to introduce synthetically useful S-tert-butylthio groups into peptides. |
| | S-tert-Butylmercapto-l-cysteine Preparation Products And Raw materials |
|