|
|
| | 2-Bromo-4'-hydroxy-3'-nitroacetophenone Basic information |
| Product Name: | 2-Bromo-4'-hydroxy-3'-nitroacetophenone | | Synonyms: | α-Bromo-3'-nitro-4'-hydroxyacetophenone;2-broMo-1-(4-hydroxy-3-nitrophenyl)ethan-1-one;2-bromo-3-nitro-4-hydroxyacetophenone;alpha-bromo-4-hydroxy-3-nitroacetophenone;2-bromo-1-(4-hydroxy-3-nitrophenyl)ethanone;(2R,3R,4S,5E)-5-[(2,4-dinitrophenyl)hydrazinylidene]pentane-1,2,3,4-tetrol;Ethanone, 2-bromo-1-(4-hydroxy-3-nitrophenyl)-;2-Bromo-4'-hydroxy-3'-nitroacetophenone | | CAS: | 5029-61-8 | | MF: | C8H6BrNO4 | | MW: | 260.04 | | EINECS: | | | Product Categories: | | | Mol File: | 5029-61-8.mol |  |
| | 2-Bromo-4'-hydroxy-3'-nitroacetophenone Chemical Properties |
| Melting point | 93℃ | | Boiling point | 150-155 °C(Press: 0.2 Torr) | | density | 1.800±0.06 g/cm3(Predicted) | | pka | 4.77±0.14(Predicted) | | form | solid | | InChI | 1S/C8H6BrNO4/c9-4-8(12)5-1-2-7(11)6(3-5)10(13)14/h1-3,11H,4H2 | | InChIKey | ADFUHIYILOQDHG-UHFFFAOYSA-N | | SMILES | Oc1ccc(cc1[N+]([O-])=O)C(=O)CBr | | EPA Substance Registry System | Ethanone, 2-bromo-1-(4-hydroxy-3-nitrophenyl)- (5029-61-8) |
| Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 2-Bromo-4'-hydroxy-3'-nitroacetophenone Usage And Synthesis |
| | 2-Bromo-4'-hydroxy-3'-nitroacetophenone Preparation Products And Raw materials |
|