| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Benzyl (S)-2-(cyanomethyl)piperazine-1-carboxylate manufacturers
|
| | Benzyl (S)-2-(cyanomethyl)piperazine-1-carboxylate Basic information |
| Product Name: | Benzyl (S)-2-(cyanomethyl)piperazine-1-carboxylate | | Synonyms: | 1-Piperazinecarboxylic acid, 2-(cyanomethyl)-, phenylmethyl ester, (2S)-;Benzyl (S)-2-(Cyanomethyl)piperazine-1-carboxylate;Benzyl (S)-2-(cyanomethyl)piperazine-1-carboxylate hydrochloride;1-benzyl 4-(tert-butyl) (S)-2-(cyanomethyl)piperazine-1,4-dicarboxylate;benzyl (2S)-2-(cyanomethyl)piperazine-1-carboxylate;Benzyl 2-(cyanomethyl)piperazine-1-carboxylate;(S)-benzyl 2-(cyanomethyl)piperazine-1-carboxylate;Benzyl ( S )-2-( cyanomethyl ) piperazine - l - carboxylate | | CAS: | 2158302-01-1 | | MF: | C14H17N3O2 | | MW: | 259.3 | | EINECS: | | | Product Categories: | | | Mol File: | 2158302-01-1.mol |  |
| | Benzyl (S)-2-(cyanomethyl)piperazine-1-carboxylate Chemical Properties |
| Boiling point | 450.9±30.0 °C(Predicted) | | density | 1.163±0.06 g/cm3(Predicted) | | storage temp. | RT, protect from light | | pka | 7.69±0.40(Predicted) | | Appearance | Colorless to light yellow Viscous liquid | | InChI | InChI=1S/C14H17N3O2/c15-7-6-13-10-16-8-9-17(13)14(18)19-11-12-4-2-1-3-5-12/h1-5,13,16H,6,8-11H2/t13-/m0/s1 | | InChIKey | QSKMFYCQRQLYMF-ZDUSSCGKSA-N | | SMILES | N1(C(OCC2=CC=CC=C2)=O)CCNC[C@@H]1CC#N |
| | Benzyl (S)-2-(cyanomethyl)piperazine-1-carboxylate Usage And Synthesis |
| Synthesis | To a solution of I-benzyl 4-tert-butyl (2S)-2-(cyanomethyl) piperazine-1,4-dicarboxylate (6.0 g, 1.0 eq) in dioxane (20.8 mL) was added 4.0 M HCl in dioxane (20.8 mL, 5.0 eq). The mixture was stirred at 20 °C for 1 hour. Then NaHCO3 was added to the reaction mixture until pH>7, after which the reaction was concentrated under reduced pressure to remove dioxane. The residue was diluted with H2O (50 mL) and extracted with ethyl acetate (50 mLx3). The combined organic layers were washed with H2O (20 mL), dried over Na2SO4, filtered, and concentrated under reduced pressure to give a residue. The product benzyl (2S)-2- (cyanomethyl) piperazine-1-carboxylate (4.1 g, 95% yield) was obtained as a yellow oil. |
| | Benzyl (S)-2-(cyanomethyl)piperazine-1-carboxylate Preparation Products And Raw materials |
|