tert-butyl (S)-3-(cyanomethyl)piperazine-1-carboxylate manufacturers
|
| | tert-butyl (S)-3-(cyanomethyl)piperazine-1-carboxylate Basic information |
| Product Name: | tert-butyl (S)-3-(cyanomethyl)piperazine-1-carboxylate | | Synonyms: | tert-butyl (S)-3-(cyanomethyl)piperazine-1-carboxylate;(S)-tert-Butyl 3-(cyanomethyl)piperazine-1-carboxylate;1-Piperazinecarboxylic acid, 3-(cyanomethyl)-, 1,1-dimethylethyl ester, (3S)-;(S)-4-Boc-piperazine-2-acetonitrile;tert-butyl (3S)-3-(cyanomethyl)piperazine-1-carboxylate;(S)-4-Boc-2-(cyanomethyl)piperazine | | CAS: | 1589082-06-3 | | MF: | C11H19N3O2 | | MW: | 225.29 | | EINECS: | | | Product Categories: | | | Mol File: | 1589082-06-3.mol |  |
| | tert-butyl (S)-3-(cyanomethyl)piperazine-1-carboxylate Chemical Properties |
| Boiling point | 361.1±17.0 °C(Predicted) | | density | 1.064±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 7.20±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H19N3O2/c1-11(2,3)16-10(15)14-7-6-13-9(8-14)4-5-12/h9,13H,4,6-8H2,1-3H3/t9-/m0/s1 | | InChIKey | PQMGXPIFQIFJEX-VIFPVBQESA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCN[C@@H](CC#N)C1 |
| | tert-butyl (S)-3-(cyanomethyl)piperazine-1-carboxylate Usage And Synthesis |
| | tert-butyl (S)-3-(cyanomethyl)piperazine-1-carboxylate Preparation Products And Raw materials |
|