Rabacfosadine succinate manufacturers
|
| | Rabacfosadine succinate Basic information |
| Product Name: | Rabacfosadine succinate | | Synonyms: | Rabacfosadine succinate;GS-9219 succinate;GS-9219-01;VDC 1101 succinate VDC1101 succinate;VDC-1101 succinate;ethyl (2S)-2-[[2-[2-amino-6-(cyclopropylamino)purin-9-yl]ethoxymethyl-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]phosphoryl]amino]propanoate;Rebamipide succinate | | CAS: | 1431856-99-3 | | MF: | C25H41N8O10P | | MW: | 644.62 | | EINECS: | | | Product Categories: | | | Mol File: | 1431856-99-3.mol |  |
| | Rabacfosadine succinate Chemical Properties |
| InChIKey | XLBDQSJWTNREFA-FGVWXQOBNA-N | | SMILES | C(C(=O)O)CC(=O)O.C(N1C=NC2=C(N=C(N)N=C12)NC1CC1)COCP(=O)(N[C@@H](C)C(=O)OCC)N[C@@H](C)C(=O)OCC |&1:29,37,r| |
| | Rabacfosadine succinate Usage And Synthesis |
| Description | Rabacfosadine succinate, also known as VDC-1101 or GS-9219, is a double prodrug of the nucleotide analogue 9-(2-phosphonylmethoxyethl)guanine (PMEG). It is a novel chemotherapy drug approved for the treatment of lymphoma in dogs. Rabacfosadine administered every 3 weeks is usually well tolerated and has shown significant anti-tumour activity in dogs with previously untreated medium and large cell lymphoma. | | Uses | Rabacfosadine succinate is used as the acyclic nucleoside phosphonate PMEG double prodrug. | | Mechanism of action | Rabacfosadine succinate targets lymphocytes and acts as an anti-tumour agent by inhibiting DNA synthesis through the inhibition of DNA polymerase. | | Side effects | The most common adverse reaction to Rabacfosadine succinate is gastrointestinal (anorexia/diarrhoea), which is generally resolved by supportive therapy and/or dose adjustment. Three dogs developed VCOG-CTCAE grade 5 delayed pulmonary fibrosis. |
| | Rabacfosadine succinate Preparation Products And Raw materials |
|