| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (4R)-BOC)-4-BENZYL-PYR-OBZL Basic information |
| Product Name: | (4R)-BOC)-4-BENZYL-PYR-OBZL | | Synonyms: | (4r)-boc-4-benzyl-l-pyroglutamic acid benzyl ester;(4R)-Boc-4-benzyl-L-pyroglutamic acid benzyl ester, Benzyl (2S,4R)-1-Boc-4-benzyl-5-oxo-2-pyrrolidinecarboxylate;1,2-Pyrrolidinedicarboxylic acid, 5-oxo-4-(phenylmethyl)-, 1-(1,1-dimethylethyl) 2-(phenylmethyl) ester, (2S,4R)-;(4R)-Boc-4-benzyl-Pyr-OBzl | | CAS: | 203645-44-7 | | MF: | C24H27NO5 | | MW: | 409.47 | | EINECS: | | | Product Categories: | | | Mol File: | 203645-44-7.mol |  |
| | (4R)-BOC)-4-BENZYL-PYR-OBZL Chemical Properties |
| Boiling point | 557.5±43.0 °C(Predicted) | | density | 1.204±0.06 g/cm3(Predicted) | | pka | -4.32±0.60(Predicted) | | Major Application | peptide synthesis | | InChI | 1S/C24H27NO5/c1-24(2,3)30-23(28)25-20(22(27)29-16-18-12-8-5-9-13-18)15-19(21(25)26)14-17-10-6-4-7-11-17/h4-13,19-20H,14-16H2,1-3H3/t19-,20+/m1/s1 | | InChIKey | LMILJTUPJYRGKN-UXHICEINSA-N | | SMILES | CC(C)(C)OC(=O)N1[C@@H](C[C@@H](Cc2ccccc2)C1=O)C(=O)OCc3ccccc3 |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | (4R)-BOC)-4-BENZYL-PYR-OBZL Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | (4R)-BOC)-4-BENZYL-PYR-OBZL Preparation Products And Raw materials |
|