|
|
| | 2-[(tert-butoxycarbonyl)amino]-4-phenylbutanoic acid Basic information |
| Product Name: | 2-[(tert-butoxycarbonyl)amino]-4-phenylbutanoic acid | | Synonyms: | 2-[(tert-butoxycarbonyl)amino]-4-phenylbutanoic acid;BOC D,L-HOMOPHENYLALANINE;b-(Boc-amino)-benzenebutanoic acid;Benzenebutanoicacid,-[[(1,1-dimethylethoxy)carbonyl]amino]-;3-(Boc-amino)-4-phenylbutanoic Acid;Boc-DL-β-Homophenylalanine;3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid;β-[[(1,1-Dimethylethoxy)carbonyl]amino]benzenebutanoic acid | | CAS: | 120378-17-8 | | MF: | C15H21NO4 | | MW: | 279.33 | | EINECS: | | | Product Categories: | | | Mol File: | 120378-17-8.mol | ![2-[(tert-butoxycarbonyl)amino]-4-phenylbutanoic acid Structure](CAS/20200331/GIF/120378-17-8.gif) |
| | 2-[(tert-butoxycarbonyl)amino]-4-phenylbutanoic acid Chemical Properties |
| Boiling point | 444.8±38.0 °C(Predicted) | | density | 1.139±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.43±0.10(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C15H21NO4/c1-15(2,3)20-14(19)16-12(13(17)18)10-9-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,16,19)(H,17,18) | | InChIKey | MCODLPJUFHPVQP-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(NC(OC(C)(C)C)=O)CCC1=CC=CC=C1 |
| | 2-[(tert-butoxycarbonyl)amino]-4-phenylbutanoic acid Usage And Synthesis |
| | 2-[(tert-butoxycarbonyl)amino]-4-phenylbutanoic acid Preparation Products And Raw materials |
|