| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-(tert-Butyldimethylsilyloxy)phenol 9& Basic information |
| | 4-(tert-Butyldimethylsilyloxy)phenol 9& Chemical Properties |
| Melting point | 60-64 °C (lit.) | | Boiling point | 266.4±23.0 °C(Predicted) | | density | 0.974±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | 10.24±0.15(Predicted) | | form | Powder | | color | White to off-white | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | 1S/C12H20O2Si/c1-12(2,3)15(4,5)14-11-8-6-10(13)7-9-11/h6-9,13H,1-5H3 | | InChIKey | KZTVHIZALLBXMO-UHFFFAOYSA-N | | SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(O)cc1 |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | TSCA | No | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | 4-(tert-Butyldimethylsilyloxy)phenol 9& Usage And Synthesis |
| | 4-(tert-Butyldimethylsilyloxy)phenol 9& Preparation Products And Raw materials |
|