| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (S)-(+)-2-Benzylamino-1-phenylethanol Basic information |
| | (S)-(+)-2-Benzylamino-1-phenylethanol Chemical Properties |
| Melting point | 115-118 °C(lit.) | | alpha | 57 º (C=1 IN CHLOROFORM) | | Boiling point | 375.2±12.0 °C(Predicted) | | density | 1.100±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 13.78±0.20(Predicted) | | Optical Rotation | [α]20/D +57°, c = 1 in chloroform | | InChI | 1S/C15H17NO/c17-15(14-9-5-2-6-10-14)12-16-11-13-7-3-1-4-8-13/h1-10,15-17H,11-12H2/t15-/m1/s1 | | InChIKey | XAOCLQUZOIZSHV-OAHLLOKOSA-N | | SMILES | O[C@H](CNCc1ccccc1)c2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29062990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-(+)-2-Benzylamino-1-phenylethanol Usage And Synthesis |
| Chemical Properties | White powder | | Uses | (S)-(+)-2-Benzylamino-1-phenylethanol can be used as an intermediate in the synthesis of aziridines using α-amino and α-amido ketones via asymmetric transferhydrogenationreaction. | | General Description | (S)-2-Benzylamino-1-phenylethanol can be used as a starting material in the preparation of iron catalysts applicable in the oxidation of secondary alcohols and benzylic methylene groups. |
| | (S)-(+)-2-Benzylamino-1-phenylethanol Preparation Products And Raw materials |
|