| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | N N-bis-[(R)-1-phenylethyl]dibenzo[d f][ Basic information |
| Product Name: | N N-bis-[(R)-1-phenylethyl]dibenzo[d f][ | | Synonyms: | BIPOL-A1(R), (R,R)-N-(5,7-Diox-6-phosphadibenzo[a,c]cyclohepten-6-yl)bis(1-phenylethyl)amine, O,Oμ-(2,2μ-Biphenyldiyl) N,N-bis[(R)-1-phenylethyl]phosphoramidite;N,N-bis[(1S)-1-phenylethyl]-Dibenzo[d,f][1,3,2]dioxaphosphepin-6-aMine;N,N-Bis-[(R)-1-phenylethyl]dibenzo[d,f][1,3,2]dioxaphosphepin-6-amine >=99.0%;N,N-Bis[(R)-1-phenylethyl]dibenzo[d,f][1,3,2]dioxaphosp
hepin-6-amine,99%e.e.;N,N-Bis[(1R)-(+)-phenylethyl]dibenzo[d,f][1,3,2]dioxaphosphepin-6-amine,97%;Dibenzo[d,f][1,3,2]dioxaphosphepin-6-amine, N,N-bis[(1R)-1-phenylethyl]-;N,N-Bis-[(R)-1-phenylethyl]dibenzo[d,f][1,3,2]dioxaphosphepin-6-amine;N N-bis-[(R)-1-phenylethyl]dibenzo[d f][ | | CAS: | 500103-26-4 | | MF: | C28H26NO2P | | MW: | 439.49 | | EINECS: | | | Product Categories: | Chiral Phosphine;CPN;phosphine-amine ligand | | Mol File: | 500103-26-4.mol | ![N N-bis-[(R)-1-phenylethyl]dibenzo[d f][ Structure](CAS/GIF/500103-26-4.gif) |
| | N N-bis-[(R)-1-phenylethyl]dibenzo[d f][ Chemical Properties |
| Melting point | 99-102 °C | | Boiling point | 578.4±53.0 °C(Predicted) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | pka | -0.31±0.20(Predicted) | | form | Powder | | color | white | | Sensitive | moisture sensitive | | InChI | 1S/C28H26NO2P/c1-21(23-13-5-3-6-14-23)29(22(2)24-15-7-4-8-16-24)32-30-27-19-11-9-17-25(27)26-18-10-12-20-28(26)31-32/h3-22H,1-2H3 | | InChIKey | JISGHECLGYELKD-UHFFFAOYSA-N | | SMILES | C[C@@H](N([C@H](C)c1ccccc1)P2Oc3ccccc3-c4ccccc4O2)c5ccccc5 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | N N-bis-[(R)-1-phenylethyl]dibenzo[d f][ Usage And Synthesis |
| Uses | N,N-Bis-[(R)-1-phenylethyl]dibenzo[d,f][1,3,2]dioxaphosphepin-6-amine can be used:
- In the asymmetric hydrovinylation of 1,3-diene.
- In the 1,4-asymmetric conjugate addition of 3-substituted cyclohexenones catalyzed by copper.
| | reaction suitability | reaction type: click chemistry |
| | N N-bis-[(R)-1-phenylethyl]dibenzo[d f][ Preparation Products And Raw materials |
|