| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | 4(3H)-Quinazolinone, 2-[[4-[2-(4-chlorophenoxy)acetyl]-1-piperazinyl]methyl]-3-[4-(1-methylethoxy)[1,1'-biphenyl]-3-yl]- Basic information |
| | 4(3H)-Quinazolinone, 2-[[4-[2-(4-chlorophenoxy)acetyl]-1-piperazinyl]methyl]-3-[4-(1-methylethoxy)[1,1'-biphenyl]-3-yl]- Chemical Properties |
| Boiling point | 807.0±75.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°,Cprotect from light | | solubility | DMF: 10 mg/ml; DMF:PBS (pH 7.2) (1:1): 0.25 mg/ml; DMSO: 1 mg/ml | | form | A crystalline solid | | pka | 5.05±0.10(Predicted) | | color | White to off-white | | SMILES | O=C(N(C1=C(OC(C)C)C=CC(C2=CC=CC=C2)=C1)C(CN3CCN(C(COC4=CC=C(Cl)C=C4)=O)CC3)=N5)C6=C5C=CC=C6 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4(3H)-Quinazolinone, 2-[[4-[2-(4-chlorophenoxy)acetyl]-1-piperazinyl]methyl]-3-[4-(1-methylethoxy)[1,1'-biphenyl]-3-yl]- Usage And Synthesis |
| Description | Erastin2 is a ferroptosis inducer and an inhibitor of the system xc- cystine/glutamate transporter.1,2 It inhibits glutamate release in CCF-STTG1 cells (IC50 = 0.0035 μM).2 It induces cell death in HAP1 cells when used at a concentration of 5 μM, an effect that can be blocked by the ferroptosis inhibitor ferrostatin-1 or deferoxamine .1 Erastin2 also induces ferroptotic cell death in HT-1080 cells (EC50 = 0.15 μM), an effect that can be blocked by the reducing agent β-mercaptoethanol (EC50 = >20 μM).3 It increases lipid peroxidation in HT-1080 cells when used at a concentration of 1 μM. | | Uses | Erastin2, an Erastin (HY-15763) analog, is a ferroptosis inducer and a potent, selective inhibitor of the system xc(-) cystine/glutamate transporter[1][2][3][4] | | References | 1. Cao, J.Y., Poddar, A., Magtanong, L., et al. A genome-wide haploid genetic screen identifies regulators of glutathione abundance and ferroptosis sensitivity Cell Rep. 26(6),1544-1556(2019). 2. Dixon, S.J., Patel, D.N., Welsch, M., et al. Pharmacological inhibition of cystine-glutamate exchange induces endoplasmic reticulum stress and ferroptosis Elife 3,e02523(2014). 3. Magtanong, L., Ko, P.-J., To, M., et al. Exogenous monounsaturated fatty acids promote a ferroptosis-resistant cell state Cell Chem. Biol. 26(3),420-432(2019). |
| | 4(3H)-Quinazolinone, 2-[[4-[2-(4-chlorophenoxy)acetyl]-1-piperazinyl]methyl]-3-[4-(1-methylethoxy)[1,1'-biphenyl]-3-yl]- Preparation Products And Raw materials |
|