2-[2-[(2-ETHYLHEXYL)OXY]ETHOXY]ETHANOL manufacturers
|
| | 2-[2-[(2-ETHYLHEXYL)OXY]ETHOXY]ETHANOL Basic information |
| Product Name: | 2-[2-[(2-ETHYLHEXYL)OXY]ETHOXY]ETHANOL | | Synonyms: | di(ethyleneglycol)2-ethylhexylether;2-[2-[(2-ETHYLHEXYL)OXY]ETHOXY]ETHANOL;Ethanol, 2-2-(2-ethylhexyl)oxyethoxy-;2-[2-[(2-ethylhexyl)oxy]ethoxy]-ethano;2-Ethyl Hexyl Di Glycol;Diethylene glycol mono2-ethylhexyl ether;DiethyleneGlycolMono2-EthylhexylEther(EHDG);iethyleneglycolmono2-ethylhexylether | | CAS: | 1559-36-0 | | MF: | C12H26O3 | | MW: | 218.33 | | EINECS: | | | Product Categories: | | | Mol File: | 1559-36-0.mol | ![2-[2-[(2-ETHYLHEXYL)OXY]ETHOXY]ETHANOL Structure](CAS/GIF/1559-36-0.gif) |
| | 2-[2-[(2-ETHYLHEXYL)OXY]ETHOXY]ETHANOL Chemical Properties |
| Boiling point | 272 °C(lit.) | | density | 0.918 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.442(lit.) | | Fp | 113 °C | | pka | 14.37±0.10(Predicted) | | Specific Gravity | 0.9234 | | InChI | InChI=1S/C12H26O3/c1-3-5-6-12(4-2)11-15-10-9-14-8-7-13/h12-13H,3-11H2,1-2H3 | | InChIKey | OADIZUFHUPTFAG-UHFFFAOYSA-N | | SMILES | C(O)COCCOCC(CC)CCCC | | EPA Substance Registry System | Ethanol, 2-[2-[(2-ethylhexyl)oxy]ethoxy]- (1559-36-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | TSCA | TSCA listed |
| | 2-[2-[(2-ETHYLHEXYL)OXY]ETHOXY]ETHANOL Usage And Synthesis |
| Toxics Screening Level | The initial threshold screening level (ITSL) for DGEHE is 22 μg/m3 based on an annual averaging time. |
| | 2-[2-[(2-ETHYLHEXYL)OXY]ETHOXY]ETHANOL Preparation Products And Raw materials |
|