|
|
| | 4-Chloro-2,3-dimethylpyridine 1-oxide Basic information |
| Product Name: | 4-Chloro-2,3-dimethylpyridine 1-oxide | | Synonyms: | 4-Chloro-2,3-dimethylpyridine-N-oxide ,98%;4-Chloro-2,3-dimethy;3-DiMethyl-4-chloropyridine N-oxide;4-chloro-2,3-diMethyl-1$l^{5}-pyridin-1-one;2,3-DiMethyl-4-chloropyridne-n-oxide;4-Chloro-2,3-lutidine N-oxide, 4-Chloro-2,3-dimethylpyridinium-1-olate;nsc 275262;2,3-DIMETHYL-4-CHLOROPYRIDINE-N-OXIDE | | CAS: | 59886-90-7 | | MF: | C7H8ClNO | | MW: | 157.6 | | EINECS: | 611-910-8 | | Product Categories: | Intermediates of Rabeprazole;Heterocycles;Nitric Oxide Reagents;Heterocycle-Pyridine series;Rabeprazole;PHARMACEUTICAL INTERMEDIATES;Pyridines;bc0001 | | Mol File: | 59886-90-7.mol |  |
| | 4-Chloro-2,3-dimethylpyridine 1-oxide Chemical Properties |
| Melting point | 103-105°C | | Boiling point | 338.5°C | | density | 1.19 | | vapor pressure | 0.346Pa at 25℃ | | Fp | 158.5°C | | storage temp. | Room temperature. | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 1.28±0.10(Predicted) | | color | Pale Yellow to Light Beige | | InChI | InChI=1S/C7H8ClNO/c1-5-6(2)9(10)4-3-7(5)8/h3-4H,1-2H3 | | InChIKey | MCUYHRNUDDANSO-UHFFFAOYSA-N | | SMILES | C1(C)[N+]([O-])=CC=C(Cl)C=1C | | LogP | 0.4 at 25℃ | | CAS DataBase Reference | 59886-90-7(CAS DataBase Reference) |
| Safety Statements | 24/25 | | HS Code | 29333990 |
| | 4-Chloro-2,3-dimethylpyridine 1-oxide Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | An intermediate in the synthesis of rabeprazole (R070500). | | Synthesis | 83.0 g (0.49 mol) of 4-nitro-2,3-dimethylpyridine N-oxide and 90 g (1.54 mol) of NaCl were admixed with 1350 ml of CH3CN, 180 ml of aq. HCl (36%) and 16.6 g of benzyltributylammonium chloride, and the resulting suspension was boiled under reflux with stirring for 12 h. The resulting reaction mixture was adjusted to PH=9 using 350 ml of 20% NaOH, wherefor the existing precipitate largely dissolved. The organic phase was separated off, water was added to the aqueous phase until the precipitate had completely dissolved, and it was subsequently extracted using dichloromethane. The organic phases were combined and the solvent was removed under reduced pressure. 76.6 g (98.5%) of 4-Chloro-2,3-dimethylpyridine 1-oxide were obtained.
 |
| | 4-Chloro-2,3-dimethylpyridine 1-oxide Preparation Products And Raw materials |
|