|
|
| | 4-NITRO-2,6-DIPHENYLPHENOL Basic information |
| | 4-NITRO-2,6-DIPHENYLPHENOL Chemical Properties |
| Melting point | 137-139 °C(lit.) | | Boiling point | 455.2±45.0 °C(Predicted) | | density | 1.265±0.06 g/cm3(Predicted) | | Water Solubility | Insoluble in water | | form | powder to crystal | | pka | 7.10±0.44(Predicted) | | color | Light orange to Yellow to Green | | InChI | 1S/C18H13NO3/c20-18-16(13-7-3-1-4-8-13)11-15(19(21)22)12-17(18)14-9-5-2-6-10-14/h1-12,20H | | InChIKey | YCXQKJXTGDYKIO-UHFFFAOYSA-N | | SMILES | Oc1c(cc(cc1-c2ccccc2)[N+]([O-])=O)-c3ccccc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 2908.99.9000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-NITRO-2,6-DIPHENYLPHENOL Usage And Synthesis |
| Uses | 4-Nitro-2,6-diphenylphenol reacts with nitrogen dioxide in benzene solution to give the C2-epimeric 2,6-dihydroxy-4,5-dinitrocyclohex-3-enones. | | General Description | 4-Nitro-2,6-diphenylphenol reacts with nitrogen dioxide in benzene solution to give the C2-epimeric 2,6-dihydroxy-4,5-dinitrocyclohex-3-enones. |
| | 4-NITRO-2,6-DIPHENYLPHENOL Preparation Products And Raw materials |
|