| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- 1-Naphthaleneethanol
-
- $70.00
-
2025-06-20
- CAS:773-99-9
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 20 tons
|
| | 1-Naphthaleneethanol Basic information |
| | 1-Naphthaleneethanol Chemical Properties |
| Melting point | 62-65 °C (lit.) | | Boiling point | 186 °C/17 mmHg (lit.) | | density | 0.9900 (rough estimate) | | refractive index | 1.5340 (estimate) | | Fp | 186°C/17mm | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid or Crystalline Powder | | pka | 14.63±0.10(Predicted) | | color | White to off-white | | InChI | InChI=1S/C12H12O/c13-9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7,13H,8-9H2 | | InChIKey | RXWNCMHRJCOWDK-UHFFFAOYSA-N | | SMILES | C1(CCO)=C2C(C=CC=C2)=CC=C1 | | CAS DataBase Reference | 773-99-9(CAS DataBase Reference) | | NIST Chemistry Reference | 1-Naphthaleneethanol(773-99-9) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29062990 | | Storage Class | 11 - Combustible Solids |
| | 1-Naphthaleneethanol Usage And Synthesis |
| | 1-Naphthaleneethanol Preparation Products And Raw materials |
|