| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | tert-Butyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate Basic information |
| Product Name: | tert-Butyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate | | Synonyms: | 3-(BOC-AMINO)PHENYLBORONIC ACID PINACOL ESTER;3-(TERT-BUTOXYCARBONYLAMINO)PHENYLBORONIC ACID, PINACOL ESTER;T-BUTYL N-[3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE-2-YL)PHENYL]CARBAMATE;tert-Butyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-;3-(Boc-amino)benzeneboronic acid pinacol ester, 97%;3-(Boc-amino)phenylboronic acid pinacol ester, tert-Butyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate;3-Aminobenzeneboronic acid, pinacol ester, N-BOC protected;tert-Butyl [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate, 3-[(tert-Butoxycarbonyl)amino]benzeneboronic acid, pinacol ester | | CAS: | 330793-09-4 | | MF: | C17H26BNO4 | | MW: | 319.2 | | EINECS: | 200-528-9 | | Product Categories: | 6;N-BOC | | Mol File: | 330793-09-4.mol | ![tert-Butyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate Structure](CAS/GIF/330793-09-4.gif) |
| | tert-Butyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate Chemical Properties |
| Melting point | 148-153 °C(lit.) | | Boiling point | 387.0±25.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 13.97±0.70(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C17H26BNO4/c1-15(2,3)21-14(20)19-13-10-8-9-12(11-13)18-22-16(4,5)17(6,7)23-18/h8-11H,1-7H3,(H,19,20) | | InChIKey | ANQAOGOIWVMGCH-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC1=CC=CC(B2OC(C)(C)C(C)(C)O2)=C1 | | CAS DataBase Reference | 330793-09-4(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | tert-Butyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate Usage And Synthesis |
| | tert-Butyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate Preparation Products And Raw materials |
|