|
|
| | 1,2-DIETHYLBENZENE Basic information |
| | 1,2-DIETHYLBENZENE Chemical Properties |
| Melting point | -31 °C (lit.) | | Boiling point | 183 °C (lit.) | | density | 0.88 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.502(lit.) | | Fp | 121 °F | | solubility | soluble in DMSO, Methanol | | form | Oil | | color | Clear Colorless | | Odor Threshold | 0.0094ppm | | Water Solubility | Miscible with alcohol, benzene and carbon tetrachloride. Immiscible with water. | | BRN | 1904392 | | InChI | InChI=1S/C10H14/c1-3-9-7-5-6-8-10(9)4-2/h5-8H,3-4H2,1-2H3 | | InChIKey | KVNYFPKFSJIPBJ-UHFFFAOYSA-N | | SMILES | C1(CC)=CC=CC=C1CC | | LogP | 3.720 | | CAS DataBase Reference | 135-01-3(CAS DataBase Reference) | | EPA Substance Registry System | o-Diethylbenzene (135-01-3) |
| | 1,2-DIETHYLBENZENE Usage And Synthesis |
| Uses | 1,2-Diethylbenzene is used as an intermediate and a building block in organic synthesis. 1,2-Diethylbenzene is used as one of the chemical composition of essential oils from flower and leaf of korean mint. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 37, p. 3545, 1972 DOI: 10.1021/jo00795a036 |
| | 1,2-DIETHYLBENZENE Preparation Products And Raw materials |
|