|
|
| | 4-(1H-Imidazol-1-yl)benzaldehyde Basic information |
| | 4-(1H-Imidazol-1-yl)benzaldehyde Chemical Properties |
| Melting point | 153-155 °C(lit.) | | Boiling point | 351.1±25.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 5.07±0.10(Predicted) | | color | Light yellow to Yellow to Orange | | InChI | InChI=1S/C10H8N2O/c13-7-9-1-3-10(4-2-9)12-6-5-11-8-12/h1-8H | | InChIKey | DCICUQFMCRPKHZ-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(N2C=NC=C2)C=C1 | | CAS DataBase Reference | 10040-98-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29332900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-(1H-Imidazol-1-yl)benzaldehyde Usage And Synthesis |
| Chemical Properties | White to light brown solid | | Uses |
4-(1H-Imidazol-1-yl)benzaldehyde could be used to synthesis (E)-3-[4-(1H-imidazol-1-yl)phenyl]-1-(4-methylphenyl)prop-2-en-1-one with 4′-methylacetophenone through Claisen–Schmidt condensation. This novel compound is suitable for anti-aspergillus activity study[1].
| | Synthesis | General procedure for the synthesis of 4-(imidazol-1-yl)benzaldehyde from imidazole and p-fluorobenzaldehyde: A mixture of p-fluorobenzaldehyde (25.0 g, 0.200 mol), imidazole (0.300 mol), and anhydrous potassium carbonate (40.0 g) was dissolved in DMF (300 mL) under dry conditions, and catalytic amount of Aliquat 336 reagent was added. The reaction mixture was refluxed at 100 °C for 24 hours. Upon completion of the reaction, the reaction mixture was concentrated under reduced pressure and cooled to room temperature. Subsequently, the concentrate was poured into ice water and allowed to stand overnight. The precipitated solid product was filtered, washed with water and recrystallized with methanol to afford the target compound 4-(1H-imidazol-1-yl)benzaldehyde (Ia) in 92% yield as yellow crystals with a melting point of 152°C (in agreement with literature reports) [34,44]. | | References | [1] N. Bailey, Bradley O. Ashburn. “(E)-3-[4-(1H-Imidazol-1-yl)phenyl]-1-(4-methylphenyl)prop-2-en-1-one.” Molbank 1 1 (2021). |
| | 4-(1H-Imidazol-1-yl)benzaldehyde Preparation Products And Raw materials |
|