- Prodan
-
- $33.00
-
2026-07-15
- CAS:70504-01-7
- Purity:
- Supply Ability: 10g
|
| Product Name: | PRODAN | | Synonyms: | N,N-DIMETHYL-6-PROPIONYL-2-NAPHTHYLAMINE , FOR FLUORESCENCE;2-(Dimethylamino)-6-propionylnaphthalene, 6-Propionyl-2-(dimethylamino)naphthalene, Prodan;1-(6-(Dimethylamino)naphthalen-2-yl)propan-1-one;1-(6-(Dimethylamino)-2-naphthalenyl)-1-propanone;1-Propanone, 1-(6-(dimethylamino)-2-naphthalenyl)-;2-Propionyl-6-diMethyl-
aMinonaphthalene;6-Propanoyl-2-(N,N-diMethylaMino)
naphthalene;Prodan (fluorophore) | | CAS: | 70504-01-7 | | MF: | C15H17NO | | MW: | 227.3 | | EINECS: | | | Product Categories: | Pharmaceuticals;Amines;Aromatics;Fluorescent Labels & Indicators;Intermediates & Fine Chemicals | | Mol File: | 70504-01-7.mol |  |
| | PRODAN Chemical Properties |
| Melting point | 137 °C(lit.) | | Boiling point | 386.2±17.0 °C(Predicted) | | density | 1.084±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMF: soluble | | form | Solid | | pka | 4.31±0.40(Predicted) | | color | Pale Yellow to Yellow | | Appearance | Solid Powder | | λmax | 362nm(EtOH)(lit.) | | BRN | 2723587 | | InChI | 1S/C15H17NO/c1-4-15(17)13-6-5-12-10-14(16(2)3)8-7-11(12)9-13/h5-10H,4H2,1-3H3 | | InChIKey | MPPQGYCZBNURDG-UHFFFAOYSA-N | | SMILES | CCC(=O)c1ccc2cc(ccc2c1)N(C)C |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 8-10 | | HS Code | 2922.39.4500 | | Storage Class | 11 - Combustible Solids |
| | PRODAN Usage And Synthesis |
| Description | Prodan is a lipophilic, environment-sensitive fluorescent probe for tubulin. | | Uses | When prodan is incorporated into membranes, its fluorescence spectra are sensitive to the physical state of the surrounding phospholipids. | | Uses | Prodan is widely used as a fluorescent molecule probe because of its significant Stokes shift in polar solvents. | | Definition | ChEBI: 2-propionyl-6-dimethylaminonaphthalene is a 2-acyl-6-dimethylaminonaphthalene. |
| | PRODAN Preparation Products And Raw materials |
|