| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Sodium ketoisocaproate manufacturers
|
| | Sodium ketoisocaproate Basic information |
| Product Name: | Sodium ketoisocaproate | | Synonyms: | Sodium ketoisocaproate;SODIUM 4-METHYL-2-OXOVALERATE;SODIUM ALPHA-KETOISOCAPRATE;2-KETOISOCAPROIC ACID SODIUM SALT;2-KETOISOHEXANOIC ACID SODIUM SALT;A-KETOISOCAPROIC ACID, SODIUM SALT;ALPHA-KETOISOCAPROIC ACID SODIUM SALT;4-Methyl-2-oxopentanoic acid monosodium salt | | CAS: | 4502-00-5 | | MF: | C6H9NaO3 | | MW: | 152.12 | | EINECS: | 224-816-3 | | Product Categories: | pharmacetical | | Mol File: | 4502-00-5.mol |  |
| | Sodium ketoisocaproate Chemical Properties |
| Melting point | 275 °C (dec.)(lit.) | | storage temp. | 2-8°C | | solubility | Water (Slightly) | | form | Solid | | color | White to Off-White | | Odor | at 100.00 %. butyric valeric buttery | | Odor Type | buttery | | biological source | synthetic | | JECFA Number | 633.1 | | BRN | 4239297 | | Stability: | Hygroscopic | | Major Application | flavors and fragrances | | InChI | 1S/C6H10O3.Na/c1-4(2)3-5(7)6(8)9;/h4H,3H2,1-2H3,(H,8,9);/q;+1/p-1 | | InChIKey | IXFAZKRLPPMQEO-UHFFFAOYSA-M | | SMILES | [Na+].CC(C)CC(=O)C([O-])=O | | LogP | 0.17 | | CAS DataBase Reference | 4502-00-5(CAS DataBase Reference) |
| Safety Statements | 24/25-22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Sodium ketoisocaproate Usage And Synthesis |
| Occurrence | Reported found in banana, asparagus, cheese, white wine, cocoa, blue cheese and provolone cheese. | | Uses | Sodium 4-methyl-2-oxovalerate has been used for quantifying branched-chain keto acids from cell extracts by HPLC-fluorescence method. | | Uses | 4-Methyl-2-oxovaleric Acid is an α-ketomonocarboxylic acid that triggers insulin release by acting upon receptor sites which differ from those occupied by amino acids. 4-Methyl-2-oxovaleric Acid is an intermediate in the metabolism of Leucine. | | Biochem/physiol Actions | α-Ketoisocaproic acid is a leucine metabolite that is known to induce insulin secretion from the βcells of pancreas. Enteral infusion of aα-Ketoisocaproate is found to ameliorate, endotoxemic condition. The resulting ketone bodies obtained from its conversion, might serve as an energy source. Accumulation of α-Ketoisocaproic acid is characterized in branched chain ketoaciduria, which is caused due to the lack of branched chain L-2-keto acid dehydrogenase activity. α-Ketoisocaproic acid causes dissociation in the oxidative phosphorylation reaction and acts as a metabolic inhibitor of α-ketoglutarate dehydrogenase. Thus, leads to a defect in the mitochondrial homeostasis, observed in branched chain ketoaciduria. | | IC 50 | Human Endogenous Metabolite |
| | Sodium ketoisocaproate Preparation Products And Raw materials |
|