|
|
| | Homo-L-tyrosine, Hydrobromide Basic information |
| | Homo-L-tyrosine, Hydrobromide Chemical Properties |
| Melting point | 220-225°C | | storage temp. | Inert atmosphere,2-8°C | | solubility | DMSO, Methanol | | form | Solid | | color | Off-White | | InChI | InChI=1/C10H13NO3.BrH/c11-9(10(13)14)6-3-7-1-4-8(12)5-2-7;/h1-2,4-5,9,12H,3,6,11H2,(H,13,14);1H/t9-;/s3 | | InChIKey | URCVTTXLQQVTHD-OVMXBOEKNA-N | | SMILES | C(C1C=CC(O)=CC=1)C[C@H](N)C(=O)O.Br |&1:9,r| | | CAS DataBase Reference | 141899-12-9(CAS DataBase Reference) |
| | Homo-L-tyrosine, Hydrobromide Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Homo-L-tyrosine hydrobromide is used in the preparation of azoles as oral antidiabetic agents. |
| | Homo-L-tyrosine, Hydrobromide Preparation Products And Raw materials |
|