| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | Triisobutyl phosphite Basic information |
| Product Name: | Triisobutyl phosphite | | Synonyms: | Phosphorous acid triisobutyl;Phosphorous acid triisobutyl ester;tris(2-methylpropyl) phosphite;Phosphorous acid, tris(2-methylpropyl) ester;Triisobutyl phosphite | | CAS: | 1606-96-8 | | MF: | C12H27O3P | | MW: | 250.31 | | EINECS: | 216-528-1 | | Product Categories: | | | Mol File: | 1606-96-8.mol |  |
| | Triisobutyl phosphite Chemical Properties |
| Boiling point | 234-235°C | | density | 0.906 g/cm3 | | InChI | InChI=1S/C12H27O3P/c1-10(2)7-13-16(14-8-11(3)4)15-9-12(5)6/h10-12H,7-9H2,1-6H3 | | InChIKey | NURJXHUITUPBOD-UHFFFAOYSA-N | | SMILES | P(OCC(C)C)(OCC(C)C)OCC(C)C |
| | Triisobutyl phosphite Usage And Synthesis |
| | Triisobutyl phosphite Preparation Products And Raw materials |
|