| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Phosphorous acid Tris(2-ethylhexyl) ester Basic information |
| Product Name: | Phosphorous acid Tris(2-ethylhexyl) ester | | Synonyms: | 2-ETHYL-1-HEXANOL PHOSPHITE;2-ETHYL-1-HEXANOL TRIPHOSPHITE;PHOSPHOROUS ACID TRIOCTYL ESTER;TRI(2-ETHYLHEXYL)PHOSPHITE;TRIOCTYL PHOSPHITE;2-ethyl-1-hexanophosphite;2-ethyl-1-hexanophosphite(3:1);ai3-18581 | | CAS: | 301-13-3 | | MF: | C24H51O3P | | MW: | 418.63 | | EINECS: | 206-111-2 | | Product Categories: | | | Mol File: | 301-13-3.mol |  |
| | Phosphorous acid Tris(2-ethylhexyl) ester Chemical Properties |
| Boiling point | 157-164 °C(Press: 0.3 Torr) | | density | 0.89 | | refractive index | 1.4480 to 1.4520 | | Fp | 194 °C | | form | clear liquid | | color | Colorless to Almost colorless | | Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | | InChI | 1S/C24H51O3P/c1-7-13-16-22(10-4)19-25-28(26-20-23(11-5)17-14-8-2)27-21-24(12-6)18-15-9-3/h22-24H,7-21H2,1-6H3 | | InChIKey | ILLOBGFGKYTZRO-UHFFFAOYSA-N | | SMILES | CCCCC(CC)COP(OCC(CC)CCCC)OCC(CC)CCCC | | CAS DataBase Reference | 301-13-3 | | EPA Substance Registry System | Tris(2-ethylhexyl) phosphite (301-13-3) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | RTECS | TH2090000 | | TSCA | TSCA listed | | HS Code | 2920.90.5100 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 | | Toxicity | LD50 oral in rabbit: 8500mg/kg |
| | Phosphorous acid Tris(2-ethylhexyl) ester Usage And Synthesis |
| Chemical Properties | Straw-colored liquid. Insoluble in water. Combustible. | | Uses | Synthesis, plasticizers, stabilizers, lubricant and
grease additives, flameproofing compositions. | | Reactivity Profile | PHOSPHOROUS ACID TRIS(2-ETHYLHEXYL) ESTER is a reducing agent. They slowly generate flammable or noxious gases in contact with water. Phosphides react quickly upon contact with moisture or acids to give the very toxic gas phosphine; phosphides also can react vigorously with oxidizing materials. In general, materials in this group are incompatible with oxidizers such as atmospheric oxygen. They are violently incompatible with acids, particularly oxidizing acids. | | Health Hazard | ACUTE/CHRONIC HAZARDS: When heated to decomposition PHOSPHOROUS ACID TRIS(2-ETHYLHEXYL) ESTER emits toxic fumes. |
| | Phosphorous acid Tris(2-ethylhexyl) ester Preparation Products And Raw materials |
|