|
|
| | NEOMYCIN B Basic information |
| | NEOMYCIN B Chemical Properties |
| Melting point | >194°C (dec.) | | Boiling point | 658.4°C (rough estimate) | | density | 1.3548 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | 2-8°C | | solubility | Aqueous Acid (Slightly), Water (Slightly) | | form | liquid | | pka | 12.93±0.70(Predicted) | | color | clear | | biological source | Streptomyces fradiae | | Merck | 13,6482 | | Stability: | Hygroscopic | | InChIKey | PGBHMTALBVVCIT-VCIWKGPPSA-N | | SMILES | NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]3O[C@H](CO)[C@@H](O[C@H]4O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]4N)[C@H]3O)[C@H](N)[C@@H](O)[C@@H]1O |
| | NEOMYCIN B Usage And Synthesis |
| Uses | Neomycin C is an aminoglycoside antibiotic found in many topical medications. Neomycin has been used as a preventive measure for hepatic encephalopathy and hypercholesterolemia. | | Definition | ChEBI: A tetracyclic antibacterial agent derived from neomycin, being a glycoside ester of neamine and neobiosamine B. | | General Description | Chemical structure: aminoglycoside | | Biochem/physiol Actions | Neomycin is an aminoglycoside antibiotic, produced by Streptomyces containing a minimum of 85% neomycin B. It acts as a selection agent for prokaryotic cells transformed using the neo selectable marker gene. Neomycin trisulfate is used to study the cytototoxic side effects of antibiotics, platelet-derived growth factor responses in certain fibroblasts and extraction of nuclear phosphatidylinositol 4,5-bisphosphate-interacting proteins. This product is recommended for use in cell culture applications at 5 mL/L.Mode of action: This product acts by binding to the 30S and 50S subunits, causing miscoding and inhibiting initiation and elongation during protein synthesis. Neomycin also blocks voltage-sensitive Ca2+ channels without affecting the Na+/Ca2+ antiporter in neurons.Antimicrobial spectrum: Neomycin acts against both gram-positive and gram-negative bacteria | | IC 50 | Aminoglycoside |
| | NEOMYCIN B Preparation Products And Raw materials |
|